C22H23ClN2O2 — CID 154629182
2-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]benzamide (PubChem CID 154629182) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]benzamide.
| Compound Name | 2-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]benzamide |
|---|---|
| PubChem CID | 154629182 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]benzamide |
| SMILES | CC1(C)C(Oc2ccc(C#N)c(Cl)c2)C(C)(C)C1c1ccccc1C(N)=O |
| InChI | InChI=1S/C22H23ClN2O2/c1-21(2)18(15-7-5-6-8-16(15)19(25)26)22(3,4)20(21)27-14-10-9-13(12-24)17(23)11-14/h5-11,18,20H,1-4H3,(H2,25,26) |
| InChIKey | OXLULJQXGYWPPL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |