About (3-chloro-4-cyanophenyl) hypoiodite
(3-chloro-4-cyanophenyl) hypoiodite (PubChem CID 166981251) has the molecular formula C7H3ClINO
and a molecular weight of 279.46 g/mol. Its IUPAC name is (3-chloro-4-cyanophenyl) hypoiodite.
Molecular Properties
| Compound Name | (3-chloro-4-cyanophenyl) hypoiodite |
| PubChem CID | 166981251 |
| Molecular Formula | C7H3ClINO |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 278.89 |
| IUPAC Name | (3-chloro-4-cyanophenyl) hypoiodite |
| SMILES | N#Cc1ccc(OI)cc1Cl |
| InChI | InChI=1S/C7H3ClINO/c8-7-3-6(11-9)2-1-5(7)4-10/h1-3H |
| InChIKey | CURSBLPAAJDOBD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4-cyanophenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-cyanophenyl) hypoiodite?
The IUPAC name of (3-chloro-4-cyanophenyl) hypoiodite (CID 166981251) is (3-chloro-4-cyanophenyl) hypoiodite.
What is the SMILES notation for (3-chloro-4-cyanophenyl) hypoiodite?
The canonical SMILES for (3-chloro-4-cyanophenyl) hypoiodite is N#Cc1ccc(OI)cc1Cl.
What is the InChIKey of (3-chloro-4-cyanophenyl) hypoiodite?
The InChIKey is CURSBLPAAJDOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClINO/c8-7-3-6(11-9)2-1-5(7)4-10/h1-3H.
What are the key properties of (3-chloro-4-cyanophenyl) hypoiodite?
(3-chloro-4-cyanophenyl) hypoiodite has a molecular weight of 279.46 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-cyanophenyl) hypoiodite is sourced from PubChem (CID 166981251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).