About (3,4-dichlorophenyl) hypoiodite
(3,4-dichlorophenyl) hypoiodite (PubChem CID 142013696) has the molecular formula C6H3Cl2IO
and a molecular weight of 288.90 g/mol. Its IUPAC name is (3,4-dichlorophenyl) hypoiodite.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl) hypoiodite |
| PubChem CID | 142013696 |
| Molecular Formula | C6H3Cl2IO |
| Molecular Weight | 288.90 g/mol |
| Exact Mass | 287.86 |
| IUPAC Name | (3,4-dichlorophenyl) hypoiodite |
| SMILES | Clc1ccc(OI)cc1Cl |
| InChI | InChI=1S/C6H3Cl2IO/c7-5-2-1-4(10-9)3-6(5)8/h1-3H |
| InChIKey | ZHGSLRMQXYUJID-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dichlorophenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl) hypoiodite?
The IUPAC name of (3,4-dichlorophenyl) hypoiodite (CID 142013696) is (3,4-dichlorophenyl) hypoiodite.
What is the SMILES notation for (3,4-dichlorophenyl) hypoiodite?
The canonical SMILES for (3,4-dichlorophenyl) hypoiodite is Clc1ccc(OI)cc1Cl.
What is the InChIKey of (3,4-dichlorophenyl) hypoiodite?
The InChIKey is ZHGSLRMQXYUJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2IO/c7-5-2-1-4(10-9)3-6(5)8/h1-3H.
What are the key properties of (3,4-dichlorophenyl) hypoiodite?
(3,4-dichlorophenyl) hypoiodite has a molecular weight of 288.90 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl) hypoiodite is sourced from PubChem (CID 142013696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).