About 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene
1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene (PubChem CID 14935801) has the molecular formula C12H5Cl5O
and a molecular weight of 342.44 g/mol. Its IUPAC name is 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene.
Molecular Properties
| Compound Name | 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene |
| PubChem CID | 14935801 |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene |
| SMILES | Clc1cc(Cl)c(Cl)c(Oc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H5Cl5O/c13-6-3-10(16)12(17)11(4-6)18-7-1-2-8(14)9(15)5-7/h1-5H |
| InChIKey | ZVFHTYGIYIXYOJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene?
The IUPAC name of 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene (CID 14935801) is 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene.
What is the SMILES notation for 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene?
The canonical SMILES for 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene is Clc1cc(Cl)c(Cl)c(Oc2ccc(Cl)c(Cl)c2)c1.
What is the InChIKey of 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene?
The InChIKey is ZVFHTYGIYIXYOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl5O/c13-6-3-10(16)12(17)11(4-6)18-7-1-2-8(14)9(15)5-7/h1-5H.
What are the key properties of 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene?
1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene has a molecular weight of 342.44 g/mol, XLogP of 6.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene is sourced from PubChem (CID 14935801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).