C12H5Cl5O — CID 14935801
1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene (PubChem CID 14935801) has the molecular formula C12H5Cl5O and a molecular weight of 342.44 g/mol. Its IUPAC name is 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene.
| Compound Name | 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene |
|---|---|
| PubChem CID | 14935801 |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 1,2,5-trichloro-3-(3,4-dichlorophenoxy)benzene |
| SMILES | Clc1cc(Cl)c(Cl)c(Oc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H5Cl5O/c13-6-3-10(16)12(17)11(4-6)18-7-1-2-8(14)9(15)5-7/h1-5H |
| InChIKey | ZVFHTYGIYIXYOJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|