C13H10BrCl2NO — CID 114048399
5-bromo-4-(3,4-dichlorophenoxy)-2-methylaniline (PubChem CID 114048399) has the molecular formula C13H10BrCl2NO and a molecular weight of 347.04 g/mol. Its IUPAC name is 5-bromo-4-(3,4-dichlorophenoxy)-2-methylaniline.
| Compound Name | 5-bromo-4-(3,4-dichlorophenoxy)-2-methylaniline |
|---|---|
| PubChem CID | 114048399 |
| Molecular Formula | C13H10BrCl2NO |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | 5-bromo-4-(3,4-dichlorophenoxy)-2-methylaniline |
| SMILES | Cc1cc(Oc2ccc(Cl)c(Cl)c2)c(Br)cc1N |
| InChI | InChI=1S/C13H10BrCl2NO/c1-7-4-13(9(14)6-12(7)17)18-8-2-3-10(15)11(16)5-8/h2-6H,17H2,1H3 |
| InChIKey | JBDFOXAQPNCPRU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|