About 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene
2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene (PubChem CID 1491144) has the molecular formula C12H6BrCl2NO3
and a molecular weight of 362.99 g/mol. Its IUPAC name is 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene.
Molecular Properties
| Compound Name | 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene |
| PubChem CID | 1491144 |
| Molecular Formula | C12H6BrCl2NO3 |
| Molecular Weight | 362.99 g/mol |
| Exact Mass | 360.89 |
| IUPAC Name | 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C12H6BrCl2NO3/c13-9-5-7(16(17)18)1-4-12(9)19-8-2-3-10(14)11(15)6-8/h1-6H |
| InChIKey | KZHCZSXXKVIURA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene?
The IUPAC name of 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene (CID 1491144) is 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene.
What is the SMILES notation for 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene?
The canonical SMILES for 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene is O=[N+]([O-])c1ccc(Oc2ccc(Cl)c(Cl)c2)c(Br)c1.
What is the InChIKey of 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene?
The InChIKey is KZHCZSXXKVIURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrCl2NO3/c13-9-5-7(16(17)18)1-4-12(9)19-8-2-3-10(14)11(15)6-8/h1-6H.
What are the key properties of 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene?
2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene has a molecular weight of 362.99 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(3,4-dichlorophenoxy)-4-nitrobenzene is sourced from PubChem (CID 1491144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).