About 3-(3,4-dichlorophenoxy)-5-nitroaniline
3-(3,4-dichlorophenoxy)-5-nitroaniline (PubChem CID 80874924) has the molecular formula C12H8Cl2N2O3
and a molecular weight of 299.11 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)-5-nitroaniline.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenoxy)-5-nitroaniline |
| PubChem CID | 80874924 |
| Molecular Formula | C12H8Cl2N2O3 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)-5-nitroaniline |
| SMILES | Nc1cc(Oc2ccc(Cl)c(Cl)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8Cl2N2O3/c13-11-2-1-9(6-12(11)14)19-10-4-7(15)3-8(5-10)16(17)18/h1-6H,15H2 |
| InChIKey | DGKJBBHYOUHIHS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenoxy)-5-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenoxy)-5-nitroaniline?
The IUPAC name of 3-(3,4-dichlorophenoxy)-5-nitroaniline (CID 80874924) is 3-(3,4-dichlorophenoxy)-5-nitroaniline.
What is the SMILES notation for 3-(3,4-dichlorophenoxy)-5-nitroaniline?
The canonical SMILES for 3-(3,4-dichlorophenoxy)-5-nitroaniline is Nc1cc(Oc2ccc(Cl)c(Cl)c2)cc([N+](=O)[O-])c1.
What is the InChIKey of 3-(3,4-dichlorophenoxy)-5-nitroaniline?
The InChIKey is DGKJBBHYOUHIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O3/c13-11-2-1-9(6-12(11)14)19-10-4-7(15)3-8(5-10)16(17)18/h1-6H,15H2.
What are the key properties of 3-(3,4-dichlorophenoxy)-5-nitroaniline?
3-(3,4-dichlorophenoxy)-5-nitroaniline has a molecular weight of 299.11 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenoxy)-5-nitroaniline is sourced from PubChem (CID 80874924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).