C13H10ClN3O2 — CID 43518735
4-(4-chloro-3-methylphenoxy)-2,1,3-benzoxadiazol-7-amine (PubChem CID 43518735) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 43518735 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-2,1,3-benzoxadiazol-7-amine |
| SMILES | Cc1cc(Oc2ccc(N)c3nonc23)ccc1Cl |
| InChI | InChI=1S/C13H10ClN3O2/c1-7-6-8(2-3-9(7)14)18-11-5-4-10(15)12-13(11)17-19-16-12/h2-6H,15H2,1H3 |
| InChIKey | MRQRBQTZKKURHJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|