C14H13N3O4 — CID 43589811
4-(3,5-dimethoxyphenoxy)-2,1,3-benzoxadiazol-7-amine (PubChem CID 43589811) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenoxy)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-(3,5-dimethoxyphenoxy)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 43589811 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-(3,5-dimethoxyphenoxy)-2,1,3-benzoxadiazol-7-amine |
| SMILES | COc1cc(OC)cc(Oc2ccc(N)c3nonc23)c1 |
| InChI | InChI=1S/C14H13N3O4/c1-18-8-5-9(19-2)7-10(6-8)20-12-4-3-11(15)13-14(12)17-21-16-13/h3-7H,15H2,1-2H3 |
| InChIKey | PADCQWLKMANSLQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|