C14H14N4O3 — CID 43518537
4-N-(2,5-dimethoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 43518537) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-N-(2,5-dimethoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-(2,5-dimethoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 43518537 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-N-(2,5-dimethoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | COc1ccc(OC)c(Nc2ccc(N)c3nonc23)c1 |
| InChI | InChI=1S/C14H14N4O3/c1-19-8-3-6-12(20-2)11(7-8)16-10-5-4-9(15)13-14(10)18-21-17-13/h3-7,16H,15H2,1-2H3 |
| InChIKey | RKDVVYWXFYDAFU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|