C13H12N4O2 — CID 43518501
4-N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 43518501) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 43518501 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | COc1ccc(Nc2ccc(N)c3nonc23)cc1 |
| InChI | InChI=1S/C13H12N4O2/c1-18-9-4-2-8(3-5-9)15-11-7-6-10(14)12-13(11)17-19-16-12/h2-7,15H,14H2,1H3 |
| InChIKey | HFGVBXHCZLCPKB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|