C11H11N7O2 — CID 3381891
5-hydrazinyl-N-(4-methoxyphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 3381891) has the molecular formula C11H11N7O2 and a molecular weight of 273.26 g/mol. Its IUPAC name is 5-hydrazinyl-N-(4-methoxyphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | 5-hydrazinyl-N-(4-methoxyphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 3381891 |
| Molecular Formula | C11H11N7O2 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-hydrazinyl-N-(4-methoxyphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | COc1ccc(Nc2nc3nonc3nc2NN)cc1 |
| InChI | InChI=1S/C11H11N7O2/c1-19-7-4-2-6(3-5-7)13-8-9(16-12)15-11-10(14-8)17-20-18-11/h2-5H,12H2,1H3,(H,13,14,17)(H,15,16,18) |
| InChIKey | ROSUWJDHBWMKQG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|