C11H8IN5O2 — CID 3943340
N-(4-iodophenyl)-5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 3943340) has the molecular formula C11H8IN5O2 and a molecular weight of 369.12 g/mol. Its IUPAC name is N-(4-iodophenyl)-5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | N-(4-iodophenyl)-5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 3943340 |
| Molecular Formula | C11H8IN5O2 |
| Molecular Weight | 369.12 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | N-(4-iodophenyl)-5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | COc1nc2nonc2nc1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C11H8IN5O2/c1-18-11-10(13-7-4-2-6(12)3-5-7)14-8-9(15-11)17-19-16-8/h2-5H,1H3,(H,13,14,16) |
| InChIKey | GQGZHILMORGXQY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|