About 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine
5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine (PubChem CID 146200467) has the molecular formula C5H3ClN4O2
and a molecular weight of 186.56 g/mol. Its IUPAC name is 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine.
Analyze 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The IUPAC name of 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine (CID 146200467) is 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine.
What is the SMILES notation for 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The canonical SMILES for 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine is COc1nc2nonc2nc1Cl.
What is the InChIKey of 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The InChIKey is CEKZOAUFRYFKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4O2/c1-11-5-2(6)7-3-4(8-5)10-12-9-3/h1H3.
What are the key properties of 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine has a molecular weight of 186.56 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazine is sourced from PubChem (CID 146200467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).