C7H6ClN5O — CID 23736669
5-chloro-N-prop-2-enyl-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 23736669) has the molecular formula C7H6ClN5O and a molecular weight of 211.61 g/mol. Its IUPAC name is 5-chloro-N-prop-2-enyl-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | 5-chloro-N-prop-2-enyl-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 23736669 |
| Molecular Formula | C7H6ClN5O |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 5-chloro-N-prop-2-enyl-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | C=CCNc1nc2nonc2nc1Cl |
| InChI | InChI=1S/C7H6ClN5O/c1-2-3-9-5-4(8)10-6-7(11-5)13-14-12-6/h2H,1,3H2,(H,9,11,13) |
| InChIKey | AMRYUMBRWYMXGG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|