C10H15ClN4S — CID 139420056
6-chloro-4-N-prop-2-enyl-2-propylsulfanylpyrimidine-4,5-diamine (PubChem CID 139420056) has the molecular formula C10H15ClN4S and a molecular weight of 258.78 g/mol. Its IUPAC name is 6-chloro-4-N-prop-2-enyl-2-propylsulfanylpyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-prop-2-enyl-2-propylsulfanylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 139420056 |
| Molecular Formula | C10H15ClN4S |
| Molecular Weight | 258.78 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 6-chloro-4-N-prop-2-enyl-2-propylsulfanylpyrimidine-4,5-diamine |
| SMILES | C=CCNc1nc(SCCC)nc(Cl)c1N |
| InChI | InChI=1S/C10H15ClN4S/c1-3-5-13-9-7(12)8(11)14-10(15-9)16-6-4-2/h3H,1,4-6,12H2,2H3,(H,13,14,15) |
| InChIKey | ZKEXLFJXSDJBDL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|