C17H29ClN4O3S — CID 144529026
acetylene;3-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol;propane-2,2-diol (PubChem CID 144529026) has the molecular formula C17H29ClN4O3S and a molecular weight of 404.96 g/mol. Its IUPAC name is acetylene;3-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol;propane-2,2-diol.
| Compound Name | acetylene;3-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol;propane-2,2-diol |
|---|---|
| PubChem CID | 144529026 |
| Molecular Formula | C17H29ClN4O3S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | acetylene;3-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol;propane-2,2-diol |
| SMILES | C#C.CC(C)(O)O.CCCSc1nc(Cl)c(N)c(NC2CCC(O)C2)n1 |
| InChI | InChI=1S/C12H19ClN4OS.C3H8O2.C2H2/c1-2-5-19-12-16-10(13)9(14)11(17-12)15-7-3-4-8(18)6-7;1-3(2,4)5;1-2/h7-8,18H,2-6,14H2,1H3,(H,15,16,17);4-5H,1-2H3;1-2H |
| InChIKey | JGOPFRRHGCVWPI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|