C18H29ClN4O4S — CID 22268915
2-[[6-[(5-amino-2-butylsulfanyl-6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol (PubChem CID 22268915) has the molecular formula C18H29ClN4O4S and a molecular weight of 432.97 g/mol. Its IUPAC name is 2-[[6-[(5-amino-2-butylsulfanyl-6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol.
| Compound Name | 2-[[6-[(5-amino-2-butylsulfanyl-6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol |
|---|---|
| PubChem CID | 22268915 |
| Molecular Formula | C18H29ClN4O4S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[[6-[(5-amino-2-butylsulfanyl-6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol |
| SMILES | CCCCSc1nc(Cl)c(N)c(NC2CC(OCCO)C3OC(C)(C)OC23)n1 |
| InChI | InChI=1S/C18H29ClN4O4S/c1-4-5-8-28-17-22-15(19)12(20)16(23-17)21-10-9-11(25-7-6-24)14-13(10)26-18(2,3)27-14/h10-11,13-14,24H,4-9,20H2,1-3H3,(H,21,22,23) |
| InChIKey | RFQJZWPFZMOCNK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|