C20H29ClN4O5S — CID 66575799
N-[4-[[(3aR,4S,6R,6aS)-4-(2-hydroxyethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane]-6-yl]amino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]formamide (PubChem CID 66575799) has the molecular formula C20H29ClN4O5S and a molecular weight of 473.00 g/mol. Its IUPAC name is N-[4-[[(3aR,4S,6R,6aS)-4-(2-hydroxyethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane]-6-yl]amino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]formamide.
| Compound Name | N-[4-[[(3aR,4S,6R,6aS)-4-(2-hydroxyethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane]-6-yl]amino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 66575799 |
| Molecular Formula | C20H29ClN4O5S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[4-[[(3aR,4S,6R,6aS)-4-(2-hydroxyethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane]-6-yl]amino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]formamide |
| SMILES | CCCSc1nc(Cl)c(NC=O)c(N[C@@H]2C[C@H](OCCO)[C@H]3OC4(CCCC4)O[C@H]32)n1 |
| InChI | InChI=1S/C20H29ClN4O5S/c1-2-9-31-19-24-17(21)14(22-11-27)18(25-19)23-12-10-13(28-8-7-26)16-15(12)29-20(30-16)5-3-4-6-20/h11-13,15-16,26H,2-10H2,1H3,(H,22,27)(H,23,24,25)/t12-,13+,15+,16-/m1/s1 |
| InChIKey | QSMODVUKEOPMBN-BFJAYTPKSA-N |
| XLogP | 2.82 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|