C12H17ClN4O3S — CID 87885127
trans-(1S,2S)-2-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol (PubChem CID 87885127) has the molecular formula C12H17ClN4O3S and a molecular weight of 332.81 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 87885127 |
| Molecular Formula | C12H17ClN4O3S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | trans-(1S,2S)-2-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentan-1-ol |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@H]2CCC[C@@H]2O)n1 |
| InChI | InChI=1S/C12H17ClN4O3S/c1-2-6-21-12-15-10(13)9(17(19)20)11(16-12)14-7-4-3-5-8(7)18/h7-8,18H,2-6H2,1H3,(H,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | LXEVOPUQTNYVBJ-YUMQZZPRSA-N |
| XLogP | 2.87 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|