C33H29ClN4O9S — CID 139235669
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate (PubChem CID 139235669) has the molecular formula C33H29ClN4O9S and a molecular weight of 693.13 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 139235669 |
| Molecular Formula | C33H29ClN4O9S |
| Molecular Weight | 693.13 g/mol |
| Exact Mass | 692.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C33H29ClN4O9S/c1-2-18-48-33-35-27(34)24(38(42)43)28(37-33)36-29-26(47-32(41)22-16-10-5-11-17-22)25(46-31(40)21-14-8-4-9-15-21)23(45-29)19-44-30(39)20-12-6-3-7-13-20/h3-17,23,25-26,29H,2,18-19H2,1H3,(H,35,36,37)/t23-,25-,26-,29-/m1/s1 |
| InChIKey | IHMIBIUOCDBZQI-CTDWIVFPSA-N |
| XLogP | 5.99 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.13 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|