C42H39NO13 — CID 14351826
diethyl 2-[[[(2R,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]amino]methylidene]propanedioate (PubChem CID 14351826) has the molecular formula C42H39NO13 and a molecular weight of 765.77 g/mol. Its IUPAC name is diethyl 2-[[[(2R,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[(2R,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 14351826 |
| Molecular Formula | C42H39NO13 |
| Molecular Weight | 765.77 g/mol |
| Exact Mass | 765.24 |
| IUPAC Name | diethyl 2-[[[(2R,3R,4S,5S,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C42H39NO13/c1-3-50-41(48)31(42(49)51-4-2)25-43-36-35(56-40(47)30-23-15-8-16-24-30)34(55-39(46)29-21-13-7-14-22-29)33(54-38(45)28-19-11-6-12-20-28)32(53-36)26-52-37(44)27-17-9-5-10-18-27/h5-25,32-36,43H,3-4,26H2,1-2H3/t32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | WNAPVPJZAUAFEC-FGZSBDNFSA-N |
| XLogP | 4.84 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|