C36H31NO10 — CID 102290990
[(2R,3R,4S,5S,6R)-6-acetamido-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 102290990) has the molecular formula C36H31NO10 and a molecular weight of 637.64 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-6-acetamido-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S,6R)-6-acetamido-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102290990 |
| Molecular Formula | C36H31NO10 |
| Molecular Weight | 637.64 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-6-acetamido-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | CC(=O)N[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H31NO10/c1-23(38)37-32-31(47-36(42)27-20-12-5-13-21-27)30(46-35(41)26-18-10-4-11-19-26)29(45-34(40)25-16-8-3-9-17-25)28(44-32)22-43-33(39)24-14-6-2-7-15-24/h2-21,28-32H,22H2,1H3,(H,37,38)/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | JVNZTVWEJBGKQD-DSSMMGBBSA-N |
| XLogP | 4.38 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|