C30H24N4O7 — CID 134847438
[5-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 134847438) has the molecular formula C30H24N4O7 and a molecular weight of 552.54 g/mol. Its IUPAC name is [5-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [5-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134847438 |
| Molecular Formula | C30H24N4O7 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | [5-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | N#C/C(N)=C(\C#N)NC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H24N4O7/c31-16-22(33)23(17-32)34-27-26(41-30(37)21-14-8-3-9-15-21)25(40-29(36)20-12-6-2-7-13-20)24(39-27)18-38-28(35)19-10-4-1-5-11-19/h1-15,24-27,34H,18,33H2/b23-22- |
| InChIKey | ZXYGBMMEQDKIMF-FCQUAONHSA-N |
| XLogP | 2.83 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|