C27H23NO7S — CID 169448687
[(2R,3S,5R)-3,4-dibenzoyloxy-5-carbamothioyloxolan-2-yl]methyl benzoate (PubChem CID 169448687) has the molecular formula C27H23NO7S and a molecular weight of 505.55 g/mol. Its IUPAC name is [(2R,3S,5R)-3,4-dibenzoyloxy-5-carbamothioyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-3,4-dibenzoyloxy-5-carbamothioyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 169448687 |
| Molecular Formula | C27H23NO7S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | [(2R,3S,5R)-3,4-dibenzoyloxy-5-carbamothioyloxolan-2-yl]methyl benzoate |
| SMILES | NC(=S)[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23NO7S/c28-24(36)23-22(35-27(31)19-14-8-3-9-15-19)21(34-26(30)18-12-6-2-7-13-18)20(33-23)16-32-25(29)17-10-4-1-5-11-17/h1-15,20-23H,16H2,(H2,28,36)/t20-,21+,22?,23-/m1/s1 |
| InChIKey | CKTMVNDDGTXBJC-HNTVYWHESA-N |
| XLogP | 3.35 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|