C12H16ClFN4O3S — CID 144528987
(1R,2S,3S)-3-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2-fluorocyclopentan-1-ol (PubChem CID 144528987) has the molecular formula C12H16ClFN4O3S and a molecular weight of 350.80 g/mol. Its IUPAC name is (1R,2S,3S)-3-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2-fluorocyclopentan-1-ol.
| Compound Name | (1R,2S,3S)-3-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2-fluorocyclopentan-1-ol |
|---|---|
| PubChem CID | 144528987 |
| Molecular Formula | C12H16ClFN4O3S |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1R,2S,3S)-3-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2-fluorocyclopentan-1-ol |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@H]2CC[C@@H](O)[C@H]2F)n1 |
| InChI | InChI=1S/C12H16ClFN4O3S/c1-2-5-22-12-16-10(13)9(18(20)21)11(17-12)15-6-3-4-7(19)8(6)14/h6-8,19H,2-5H2,1H3,(H,15,16,17)/t6-,7+,8-/m0/s1 |
| InChIKey | NCERFBHHKKDROA-RNJXMRFFSA-N |
| XLogP | 2.81 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|