C14H13ClF2N4O2S — CID 122671631
6-chloro-N-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine (PubChem CID 122671631) has the molecular formula C14H13ClF2N4O2S and a molecular weight of 374.80 g/mol. Its IUPAC name is 6-chloro-N-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122671631 |
| Molecular Formula | C14H13ClF2N4O2S |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 6-chloro-N-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(NCc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H13ClF2N4O2S/c1-2-5-24-14-19-12(15)11(21(22)23)13(20-14)18-7-8-3-4-9(16)10(17)6-8/h3-4,6H,2,5,7H2,1H3,(H,18,19,20) |
| InChIKey | ZDZWHRKMDNGFPZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|