C17H16ClF2N3O2S — CID 162134450
4-chloro-6-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]methyl]-5-nitro-2-propylsulfanylpyrimidine (PubChem CID 162134450) has the molecular formula C17H16ClF2N3O2S and a molecular weight of 399.85 g/mol. Its IUPAC name is 4-chloro-6-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]methyl]-5-nitro-2-propylsulfanylpyrimidine.
| Compound Name | 4-chloro-6-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]methyl]-5-nitro-2-propylsulfanylpyrimidine |
|---|---|
| PubChem CID | 162134450 |
| Molecular Formula | C17H16ClF2N3O2S |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-chloro-6-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]methyl]-5-nitro-2-propylsulfanylpyrimidine |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(C[C@@H]2C[C@H]2c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C17H16ClF2N3O2S/c1-2-5-26-17-21-14(15(23(24)25)16(18)22-17)8-10-6-11(10)9-3-4-12(19)13(20)7-9/h3-4,7,10-11H,2,5-6,8H2,1H3/t10-,11-/m0/s1 |
| InChIKey | FXYDVHOPOPWQBF-QWRGUYRKSA-N |
| XLogP | 5.16 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|