C27H35F2N5O4S — CID 123171800
6-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol (PubChem CID 123171800) has the molecular formula C27H35F2N5O4S and a molecular weight of 563.67 g/mol. Its IUPAC name is 6-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol.
| Compound Name | 6-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol |
|---|---|
| PubChem CID | 123171800 |
| Molecular Formula | C27H35F2N5O4S |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 6-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol |
| SMILES | [H]/N=N/c1c(CCCC2C(O)C(O)C3OC(C)(C)OC23)nc(SCCC)nc1NC1CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H35F2N5O4S/c1-4-10-39-26-32-18(7-5-6-14-21(35)22(36)24-23(14)37-27(2,3)38-24)20(34-30)25(33-26)31-19-12-15(19)13-8-9-16(28)17(29)11-13/h8-9,11,14-15,19,21-24,30,35-36H,4-7,10,12H2,1-3H3,(H,31,32,33)/b34-30+ |
| InChIKey | BWXUCYNOXFFNOI-VBMGMRCRSA-N |
| XLogP | 5.08 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|