C25H34F3N5O3S — CID 144529133
(1S,2R,3R,4S)-1-[4-[6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-hydrazinyl-2-propylsulfanylpyrimidin-4-yl]butyl]-4-fluorocyclopentane-1,2,3-triol (PubChem CID 144529133) has the molecular formula C25H34F3N5O3S and a molecular weight of 541.64 g/mol. Its IUPAC name is (1S,2R,3R,4S)-1-[4-[6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-hydrazinyl-2-propylsulfanylpyrimidin-4-yl]butyl]-4-fluorocyclopentane-1,2,3-triol.
| Compound Name | (1S,2R,3R,4S)-1-[4-[6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-hydrazinyl-2-propylsulfanylpyrimidin-4-yl]butyl]-4-fluorocyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 144529133 |
| Molecular Formula | C25H34F3N5O3S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | (1S,2R,3R,4S)-1-[4-[6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-hydrazinyl-2-propylsulfanylpyrimidin-4-yl]butyl]-4-fluorocyclopentane-1,2,3-triol |
| SMILES | CCCSc1nc(CCCC[C@]2(O)C[C@H](F)[C@H](O)[C@H]2O)c(NN)c(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C25H34F3N5O3S/c1-2-9-37-24-31-18(5-3-4-8-25(36)12-17(28)21(34)22(25)35)20(33-29)23(32-24)30-19-11-14(19)13-6-7-15(26)16(27)10-13/h6-7,10,14,17,19,21-22,33-36H,2-5,8-9,11-12,29H2,1H3,(H,30,31,32)/t14-,17-,19+,21-,22+,25-/m0/s1 |
| InChIKey | PXCWLRHBFDLIJK-JBZGQKCOSA-N |
| XLogP | 3.42 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|