C22H26F2N6O3S — CID 68715498
(1R,2S,3R,4S)-4-[5-butylsulfanyl-7-[[2-(3,4-difluorophenyl)cyclopropyl]amino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol (PubChem CID 68715498) has the molecular formula C22H26F2N6O3S and a molecular weight of 492.55 g/mol. Its IUPAC name is (1R,2S,3R,4S)-4-[5-butylsulfanyl-7-[[2-(3,4-difluorophenyl)cyclopropyl]amino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4S)-4-[5-butylsulfanyl-7-[[2-(3,4-difluorophenyl)cyclopropyl]amino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 68715498 |
| Molecular Formula | C22H26F2N6O3S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (1R,2S,3R,4S)-4-[5-butylsulfanyl-7-[[2-(3,4-difluorophenyl)cyclopropyl]amino]triazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol |
| SMILES | CCCCSc1nc(NC2CC2c2ccc(F)c(F)c2)c2nnn([C@H]3C[C@@H](O)[C@H](O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C22H26F2N6O3S/c1-2-3-6-34-22-26-20(25-14-8-11(14)10-4-5-12(23)13(24)7-10)17-21(27-22)30(29-28-17)15-9-16(31)19(33)18(15)32/h4-5,7,11,14-16,18-19,31-33H,2-3,6,8-9H2,1H3,(H,25,26,27)/t11?,14?,15-,16+,18+,19-/m0/s1 |
| InChIKey | ZRSAUPVVTFPAAZ-JCKBBEBWSA-N |
| XLogP | 2.39 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|