C23H26F4N6O3S — CID 144529088
cis-(1S,2S)-3-(2,2-difluoroethoxy)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol (PubChem CID 144529088) has the molecular formula C23H26F4N6O3S and a molecular weight of 542.56 g/mol. Its IUPAC name is cis-(1S,2S)-3-(2,2-difluoroethoxy)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol.
| Compound Name | cis-(1S,2S)-3-(2,2-difluoroethoxy)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 144529088 |
| Molecular Formula | C23H26F4N6O3S |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | cis-(1S,2S)-3-(2,2-difluoroethoxy)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn(C3CC(OCC(F)F)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C23H26F4N6O3S/c1-2-5-37-23-29-21(28-14-7-11(14)10-3-4-12(24)13(25)6-10)18-22(30-23)33(32-31-18)15-8-16(20(35)19(15)34)36-9-17(26)27/h3-4,6,11,14-17,19-20,34-35H,2,5,7-9H2,1H3,(H,28,29,30)/t11-,14+,15?,16?,19-,20+/m0/s1 |
| InChIKey | XZVYANROJBGQCU-BXDDEUNDSA-N |
| XLogP | 3.29 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |