C28H36F2N6O5S — CID 123467566
N-[2-(3,4-difluorophenyl)cyclopropyl]-3-[4-(2,2-dimethoxyethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 123467566) has the molecular formula C28H36F2N6O5S and a molecular weight of 606.70 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)cyclopropyl]-3-[4-(2,2-dimethoxyethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-[2-(3,4-difluorophenyl)cyclopropyl]-3-[4-(2,2-dimethoxyethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 123467566 |
| Molecular Formula | C28H36F2N6O5S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)cyclopropyl]-3-[4-(2,2-dimethoxyethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCCSc1nc(NC2CC2c2ccc(F)c(F)c2)c2nnn(C3CC(OCC(OC)OC)C4OC(C)(C)OC43)c2n1 |
| InChI | InChI=1S/C28H36F2N6O5S/c1-6-9-42-27-32-25(31-18-11-15(18)14-7-8-16(29)17(30)10-14)22-26(33-27)36(35-34-22)19-12-20(39-13-21(37-4)38-5)24-23(19)40-28(2,3)41-24/h7-8,10,15,18-21,23-24H,6,9,11-13H2,1-5H3,(H,31,32,33) |
| InChIKey | VJFYJZBIGZLREQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|