C23H28F2N6O5S — CID 71607634
(1S,2S,3S,4R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2,4-triol (PubChem CID 71607634) has the molecular formula C23H28F2N6O5S and a molecular weight of 538.58 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2,4-triol.
| Compound Name | (1S,2S,3S,4R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2,4-triol |
|---|---|
| PubChem CID | 71607634 |
| Molecular Formula | C23H28F2N6O5S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (1S,2S,3S,4R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2,4-triol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@H]3[C@H](O)[C@H](O)[C@@H](OCCO)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C23H28F2N6O5S/c1-2-7-37-23-27-21(26-14-9-11(14)10-3-4-12(24)13(25)8-10)15-22(28-23)31(30-29-15)16-17(33)19(35)20(18(16)34)36-6-5-32/h3-4,8,11,14,16-20,32-35H,2,5-7,9H2,1H3,(H,26,27,28)/t11-,14+,16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | VSUYQYJCUQYWIB-QIIUYWKJSA-N |
| XLogP | 0.98 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |