C23H28F2N6O4S — CID 154538716
(1S,2R,3S)-1-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-3-(2-hydroxyethoxy)cyclopentane-1,2-diol (PubChem CID 154538716) has the molecular formula C23H28F2N6O4S and a molecular weight of 522.58 g/mol. Its IUPAC name is (1S,2R,3S)-1-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-3-(2-hydroxyethoxy)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S)-1-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-3-(2-hydroxyethoxy)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 154538716 |
| Molecular Formula | C23H28F2N6O4S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (1S,2R,3S)-1-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-3-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@]3(O)CC[C@H](OCCO)[C@H]3O)c2n1 |
| InChI | InChI=1S/C23H28F2N6O4S/c1-2-9-36-22-27-20(26-16-11-13(16)12-3-4-14(24)15(25)10-12)18-21(28-22)31(30-29-18)23(34)6-5-17(19(23)33)35-8-7-32/h3-4,10,13,16-17,19,32-34H,2,5-9,11H2,1H3,(H,26,27,28)/t13-,16+,17-,19+,23-/m0/s1 |
| InChIKey | DUXFQXXPYFSVCE-CRGMPZQMSA-N |
| XLogP | 2.15 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |