C23H28F2N6O3S — CID 174081096
2-[[(2R,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolan-2-yl]methoxy]ethanol (PubChem CID 174081096) has the molecular formula C23H28F2N6O3S and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-[[(2R,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolan-2-yl]methoxy]ethanol.
| Compound Name | 2-[[(2R,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolan-2-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 174081096 |
| Molecular Formula | C23H28F2N6O3S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 2-[[(2R,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]oxolan-2-yl]methoxy]ethanol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@H]3CO[C@@H](COCCO)C3)c2n1 |
| InChI | InChI=1S/C23H28F2N6O3S/c1-2-7-35-23-27-21(26-19-10-16(19)13-3-4-17(24)18(25)8-13)20-22(28-23)31(30-29-20)14-9-15(34-11-14)12-33-6-5-32/h3-4,8,14-16,19,32H,2,5-7,9-12H2,1H3,(H,26,27,28)/t14-,15-,16+,19-/m1/s1 |
| InChIKey | VWSCWYLFJPZCIE-OAFZBRQQSA-N |
| XLogP | 3.31 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|