C23H26F2N6O2S — CID 86291255
2-[(1S,4R)-4-[7-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-2-en-1-yl]oxyethanol (PubChem CID 86291255) has the molecular formula C23H26F2N6O2S and a molecular weight of 488.56 g/mol. Its IUPAC name is 2-[(1S,4R)-4-[7-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-2-en-1-yl]oxyethanol.
| Compound Name | 2-[(1S,4R)-4-[7-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-2-en-1-yl]oxyethanol |
|---|---|
| PubChem CID | 86291255 |
| Molecular Formula | C23H26F2N6O2S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[(1S,4R)-4-[7-[[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-2-en-1-yl]oxyethanol |
| SMILES | CCCSc1nc(N[C@H]2C[C@@H]2c2ccc(F)c(F)c2)c2nnn([C@H]3C=C[C@@H](OCCO)C3)c2n1 |
| InChI | InChI=1S/C23H26F2N6O2S/c1-2-9-34-23-27-21(26-19-12-16(19)13-3-6-17(24)18(25)10-13)20-22(28-23)31(30-29-20)14-4-5-15(11-14)33-8-7-32/h3-6,10,14-16,19,32H,2,7-9,11-12H2,1H3,(H,26,27,28)/t14-,15+,16+,19-/m0/s1 |
| InChIKey | YZLNCXTWHKASCS-MKSNKDDYSA-N |
| XLogP | 3.85 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|