C22H27ClN6O4S — CID 90958316
(1S,2R,3S,4R)-4-[7-[[2-(3-chloro-4-methoxyphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol (PubChem CID 90958316) has the molecular formula C22H27ClN6O4S and a molecular weight of 507.02 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[7-[[2-(3-chloro-4-methoxyphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol.
| Compound Name | (1S,2R,3S,4R)-4-[7-[[2-(3-chloro-4-methoxyphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 90958316 |
| Molecular Formula | C22H27ClN6O4S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (1S,2R,3S,4R)-4-[7-[[2-(3-chloro-4-methoxyphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol |
| SMILES | CCCSc1nc(NC2CC2c2ccc(OC)c(Cl)c2)c2nnn([C@@H]3C[C@H](O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C22H27ClN6O4S/c1-3-6-34-22-25-20(24-13-8-11(13)10-4-5-16(33-2)12(23)7-10)17-21(26-22)29(28-27-17)14-9-15(30)19(32)18(14)31/h4-5,7,11,13-15,18-19,30-32H,3,6,8-9H2,1-2H3,(H,24,25,26)/t11?,13?,14-,15+,18+,19-/m1/s1 |
| InChIKey | KYGMVILXLAWRJV-QEYJRFBFSA-N |
| XLogP | 2.38 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |