C24H32N6O3S — CID 91148930
(1S,2R,3R,5R)-3-(2-hydroxyethyl)-5-[7-[[2-(3-methylphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol (PubChem CID 91148930) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(2-hydroxyethyl)-5-[7-[[2-(3-methylphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(2-hydroxyethyl)-5-[7-[[2-(3-methylphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 91148930 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (1S,2R,3R,5R)-3-(2-hydroxyethyl)-5-[7-[[2-(3-methylphenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(NC2CC2c2cccc(C)c2)c2nnn([C@@H]3C[C@H](CCO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H32N6O3S/c1-3-9-34-24-26-22(25-17-12-16(17)14-6-4-5-13(2)10-14)19-23(27-24)30(29-28-19)18-11-15(7-8-31)20(32)21(18)33/h4-6,10,15-18,20-21,31-33H,3,7-9,11-12H2,1-2H3,(H,25,26,27)/t15-,16?,17?,18+,20+,21-/m0/s1 |
| InChIKey | LXVNNEACLXNOPT-PEAZFXMVSA-N |
| XLogP | 2.67 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |