C23H31N7O2S — CID 70103516
(1R,2S,3R,5S)-3-(2-aminoethyl)-5-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol (PubChem CID 70103516) has the molecular formula C23H31N7O2S and a molecular weight of 469.62 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(2-aminoethyl)-5-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(2-aminoethyl)-5-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 70103516 |
| Molecular Formula | C23H31N7O2S |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (1R,2S,3R,5S)-3-(2-aminoethyl)-5-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(NC2CC2c2ccccc2)c2nnn([C@H]3C[C@@H](CCN)[C@H](O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C23H31N7O2S/c1-2-10-33-23-26-21(25-16-12-15(16)13-6-4-3-5-7-13)18-22(27-23)30(29-28-18)17-11-14(8-9-24)19(31)20(17)32/h3-7,14-17,19-20,31-32H,2,8-12,24H2,1H3,(H,25,26,27)/t14-,15?,16?,17+,19+,20-/m1/s1 |
| InChIKey | CRKSWKWUEVJNAC-QAERVNSISA-N |
| XLogP | 2.32 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |