C21H22F2N6O2S — CID 71607666
(1S,2R,5R)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-3-ene-1,2-diol (PubChem CID 71607666) has the molecular formula C21H22F2N6O2S and a molecular weight of 460.51 g/mol. Its IUPAC name is (1S,2R,5R)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 71607666 |
| Molecular Formula | C21H22F2N6O2S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (1S,2R,5R)-5-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopent-3-ene-1,2-diol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C=C[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C21H22F2N6O2S/c1-2-7-32-21-25-19(24-14-9-11(14)10-3-4-12(22)13(23)8-10)17-20(26-21)29(28-27-17)15-5-6-16(30)18(15)31/h3-6,8,11,14-16,18,30-31H,2,7,9H2,1H3,(H,24,25,26)/t11-,14+,15+,16+,18-/m0/s1 |
| InChIKey | JMLLYABYZDIYPB-BTNRLSLSSA-N |
| XLogP | 2.80 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|