C26H31F2N5O2S — CID 123245173
3-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-4,5-dimethylidenecyclopentane-1,2-diol (PubChem CID 123245173) has the molecular formula C26H31F2N5O2S and a molecular weight of 515.63 g/mol. Its IUPAC name is 3-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-4,5-dimethylidenecyclopentane-1,2-diol.
| Compound Name | 3-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-4,5-dimethylidenecyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123245173 |
| Molecular Formula | C26H31F2N5O2S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 3-[3-[5-diazenyl-6-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]propyl]-4,5-dimethylidenecyclopentane-1,2-diol |
| SMILES | [H]/N=N/c1c(CCCC2C(=C)C(=C)C(O)C2O)nc(SCCC)nc1NC1CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H31F2N5O2S/c1-4-10-36-26-31-20(7-5-6-16-13(2)14(3)23(34)24(16)35)22(33-29)25(32-26)30-21-12-17(21)15-8-9-18(27)19(28)11-15/h8-9,11,16-17,21,23-24,29,34-35H,2-7,10,12H2,1H3,(H,30,31,32)/b33-29+ |
| InChIKey | GQQYEFOIQPRBID-XPXRSFDGSA-N |
| XLogP | 5.67 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|