C25H32F3N5OS — CID 144529015
cis-(1R,2S)-4-[4-[5-diazenyl-6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]butyl]-2-fluorocyclopentan-1-ol (PubChem CID 144529015) has the molecular formula C25H32F3N5OS and a molecular weight of 507.63 g/mol. Its IUPAC name is cis-(1R,2S)-4-[4-[5-diazenyl-6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]butyl]-2-fluorocyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-4-[4-[5-diazenyl-6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]butyl]-2-fluorocyclopentan-1-ol |
|---|---|
| PubChem CID | 144529015 |
| Molecular Formula | C25H32F3N5OS |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | cis-(1R,2S)-4-[4-[5-diazenyl-6-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-2-propylsulfanylpyrimidin-4-yl]butyl]-2-fluorocyclopentan-1-ol |
| SMILES | [H]/N=N/c1c(CCCCC2C[C@@H](O)[C@@H](F)C2)nc(SCCC)nc1N[C@@H]1C[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H32F3N5OS/c1-2-9-35-25-31-20(6-4-3-5-14-10-19(28)22(34)11-14)23(33-29)24(32-25)30-21-13-16(21)15-7-8-17(26)18(27)12-15/h7-8,12,14,16,19,21-22,29,34H,2-6,9-11,13H2,1H3,(H,30,31,32)/b33-29+/t14?,16-,19-,21+,22+/m0/s1 |
| InChIKey | VCIBZZXVACXWSG-MXLHBXSPSA-N |
| XLogP | 6.71 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|