C25H32F2N5O5S+ — CID 123619918
3-[5-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl]-5-[2-(2-hydroxyethoxy)ethoxy]cyclopentane-1,2-diol (PubChem CID 123619918) has the molecular formula C25H32F2N5O5S+ and a molecular weight of 552.62 g/mol. Its IUPAC name is 3-[5-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl]-5-[2-(2-hydroxyethoxy)ethoxy]cyclopentane-1,2-diol.
| Compound Name | 3-[5-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl]-5-[2-(2-hydroxyethoxy)ethoxy]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123619918 |
| Molecular Formula | C25H32F2N5O5S+ |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 3-[5-[[2-(3,4-difluorophenyl)cyclopropyl]amino]-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl]-5-[2-(2-hydroxyethoxy)ethoxy]cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(NC2CC2c2ccc(F)c(F)c2)c2c(n1)[N+](C1CC(OCCOCCO)C(O)C1O)=N2 |
| InChI | InChI=1S/C25H31F2N5O5S/c1-2-9-38-25-29-23(28-17-11-14(17)13-3-4-15(26)16(27)10-13)20-24(30-25)32(31-20)18-12-19(22(35)21(18)34)37-8-7-36-6-5-33/h3-4,10,14,17-19,21-22,33-35H,2,5-9,11-12H2,1H3/p+1 |
| InChIKey | WDVFMYNYAAWJMO-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|