C14H13F2N3O2S — CID 174874578
4-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidine (PubChem CID 174874578) has the molecular formula C14H13F2N3O2S and a molecular weight of 325.34 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidine.
| Compound Name | 4-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidine |
|---|---|
| PubChem CID | 174874578 |
| Molecular Formula | C14H13F2N3O2S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl]-5-nitro-2-propylsulfanylpyrimidine |
| SMILES | CCCSc1ncc([N+](=O)[O-])c(Cc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H13F2N3O2S/c1-2-5-22-14-17-8-13(19(20)21)12(18-14)7-9-3-4-10(15)11(16)6-9/h3-4,6,8H,2,5,7H2,1H3 |
| InChIKey | GQHSWAHVKLNNPK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|