C6H7N3O2S2 — CID 119098645
2,4-bis(methylsulfanyl)-5-nitropyrimidine (PubChem CID 119098645) has the molecular formula C6H7N3O2S2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2,4-bis(methylsulfanyl)-5-nitropyrimidine.
| Compound Name | 2,4-bis(methylsulfanyl)-5-nitropyrimidine |
|---|---|
| PubChem CID | 119098645 |
| Molecular Formula | C6H7N3O2S2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 2,4-bis(methylsulfanyl)-5-nitropyrimidine |
| SMILES | CSc1ncc([N+](=O)[O-])c(SC)n1 |
| InChI | InChI=1S/C6H7N3O2S2/c1-12-5-4(9(10)11)3-7-6(8-5)13-2/h3H,1-2H3 |
| InChIKey | IJBWPADDIKUKAO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|