C5H7N5O2S — CID 119096956
(2-methylsulfanyl-5-nitropyrimidin-4-yl)hydrazine (PubChem CID 119096956) has the molecular formula C5H7N5O2S and a molecular weight of 201.21 g/mol. Its IUPAC name is (2-methylsulfanyl-5-nitropyrimidin-4-yl)hydrazine.
| Compound Name | (2-methylsulfanyl-5-nitropyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 119096956 |
| Molecular Formula | C5H7N5O2S |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | (2-methylsulfanyl-5-nitropyrimidin-4-yl)hydrazine |
| SMILES | CSc1ncc([N+](=O)[O-])c(NN)n1 |
| InChI | InChI=1S/C5H7N5O2S/c1-13-5-7-2-3(10(11)12)4(8-5)9-6/h2H,6H2,1H3,(H,7,8,9) |
| InChIKey | XXVVWRBIDAOTNF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|