C15H14F2N4O2S — CID 97020546
N-cyclopropyl-2-[(1S)-1-(2,6-difluorophenyl)ethyl]sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 97020546) has the molecular formula C15H14F2N4O2S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-cyclopropyl-2-[(1S)-1-(2,6-difluorophenyl)ethyl]sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-cyclopropyl-2-[(1S)-1-(2,6-difluorophenyl)ethyl]sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 97020546 |
| Molecular Formula | C15H14F2N4O2S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-cyclopropyl-2-[(1S)-1-(2,6-difluorophenyl)ethyl]sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | C[C@H](Sc1ncc([N+](=O)[O-])c(NC2CC2)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2N4O2S/c1-8(13-10(16)3-2-4-11(13)17)24-15-18-7-12(21(22)23)14(20-15)19-9-5-6-9/h2-4,7-9H,5-6H2,1H3,(H,18,19,20)/t8-/m0/s1 |
| InChIKey | MXOKQIPNSDTXEP-QMMMGPOBSA-N |
| XLogP | 4.09 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|