C9H13N5O3S — CID 114045369
5-nitro-4-N-(1-oxothian-4-yl)pyrimidine-2,4-diamine (PubChem CID 114045369) has the molecular formula C9H13N5O3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 5-nitro-4-N-(1-oxothian-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-4-N-(1-oxothian-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114045369 |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 5-nitro-4-N-(1-oxothian-4-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc([N+](=O)[O-])c(NC2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C9H13N5O3S/c10-9-11-5-7(14(15)16)8(13-9)12-6-1-3-18(17)4-2-6/h5-6H,1-4H2,(H3,10,11,12,13) |
| InChIKey | KAJCBCPZBUCREJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|