C13H14FN5O2S — CID 67063020
5-[(4-fluoro-3-nitroanilino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 67063020) has the molecular formula C13H14FN5O2S and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-[(4-fluoro-3-nitroanilino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 5-[(4-fluoro-3-nitroanilino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 67063020 |
| Molecular Formula | C13H14FN5O2S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-[(4-fluoro-3-nitroanilino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1nc(SC)ncc1CNc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14FN5O2S/c1-15-12-8(7-17-13(18-12)22-2)6-16-9-3-4-10(14)11(5-9)19(20)21/h3-5,7,16H,6H2,1-2H3,(H,15,17,18) |
| InChIKey | CMNZRHFGGUJFMN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|